3-pyridinamine, 2-chloro-4-methoxy- - Names and Identifiers
Name | 3-Pyridinamine, 2-chloro-4-methoxy-
|
Synonyms | 2-Chloro-4-methoxypyridin-3-amine 2-Chloro-4-Methoxy-3-pyridinaMine 3-Amino-2-chloro-4-methoxypyridine 3-Pyridinamine, 2-chloro-4-methoxy- 3-pyridinamine, 2-chloro-4-methoxy- 3-Pyridinamine, 2-chloro-4-methoxy- 2-Chloro-4-Methoxy-pyridin-3-ylaMine 3H-1,2,4-Triazole-3-thione,4-amino-2,4-dihydro-5-(8-methoxyphenyl)-
|
CAS | 173435-34-2
|
InChI | InChI=1/C6H7ClN2O/c1-10-4-2-3-9-6(7)5(4)8/h2-3H,8H2,1H3 |
3-pyridinamine, 2-chloro-4-methoxy- - Physico-chemical Properties
Molecular Formula | C6H7ClN2O
|
Molar Mass | 158.59 |
Density | 1.311 |
Boling Point | 288℃ |
Flash Point | 128℃ |
Vapor Presure | 0.00232mmHg at 25°C |
Storage Condition | 2-8°C |
Refractive Index | 1.578 |
3-pyridinamine, 2-chloro-4-methoxy- - Introduction
3-Pyridinamine, 2-chloro-4-methoxy-(abbreviated as CLAMP) is an organic compound with the chemical formula C8H9ClN2O. Its nature is as follows:
1. Appearance: CLAMP is white to yellowish crystal or crystalline powder.
2. Solubility: CLAMP is almost insoluble in water and soluble in organic solvents such as ethanol and dimethylmethylene amine.
The Main uses and applications of CLAMP include the following:
1. Pharmaceutical and Chemical Industry: CLAMP can be used to synthesize various bioactive molecules, drug intermediates and drugs.
2. Pesticide: As a pesticide intermediate, CLAMP has certain application value in the agricultural field.
3. Dyes: CLAMP can be used in the field of dyes, as a dye intermediate, for the synthesis of dyes with special structures and properties.
The preparation method of CLAMP can generally be synthesized through the following steps:
1. Take pyridine and ammonia reaction to obtain pyridine -3-amine.
2. Using pyridine-3-amine as raw material, methanol is alkylated to amine group by alkylation reaction to obtain pyridine-3-amine with methoxy group.
3. Finally, the product obtained in the previous step is reacted with a chlorinating agent to replace the hydrogen atom on the amine group with a chlorine atom, thereby synthesizing 3-Pyridinamine, 2-chloro-4-methoxy-.
Regarding the security information of CLAMP, you need to pay attention to the following points:
1. Toxicity: The toxicity of CLAMP is not yet clear, but as an organic compound, direct contact with skin and inhalation of its dust should be avoided.
2. Combustibility: CLAMP is a combustible substance and should be kept away from fire and high temperature.
3. Storage: The CLAMP should be stored in a dry, cool place, away from oxidants and acids.
It should be noted that safe operating procedures should be followed when using and handling CLAMP, and use it with caution before understanding its specific nature and use. If you have any questions or need further information, please consult a professional.
Last Update:2024-04-10 22:41:03